C49H40BN5O2 — CID 164779820
2-phenyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-[3-(3,5,6-triphenylpyrazin-2-yl)phenyl]-1,3,5-triazine (PubChem CID 164779820) has the molecular formula C49H40BN5O2 and a molecular weight of 741.70 g/mol. Its IUPAC name is 2-phenyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-[3-(3,5,6-triphenylpyrazin-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-[3-(3,5,6-triphenylpyrazin-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 164779820 |
| Molecular Formula | C49H40BN5O2 |
| Molecular Weight | 741.70 g/mol |
| Exact Mass | 741.33 |
| IUPAC Name | 2-phenyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-[3-(3,5,6-triphenylpyrazin-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5nc(-c6ccccc6)c(-c6ccccc6)nc5-c5ccccc5)c4)n3)c2)OC1(C)C |
| InChI | InChI=1S/C49H40BN5O2/c1-48(2)49(3,4)57-50(56-48)40-30-18-29-39(32-40)47-54-45(36-25-15-8-16-26-36)53-46(55-47)38-28-17-27-37(31-38)44-43(35-23-13-7-14-24-35)51-41(33-19-9-5-10-20-33)42(52-44)34-21-11-6-12-22-34/h5-32H,1-4H3 |
| InChIKey | KHBOLSWTEZVFDN-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 82.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.70 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|