C22H24BN3O2 — CID 176842902
2-methyl-4-phenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 176842902) has the molecular formula C22H24BN3O2 and a molecular weight of 373.27 g/mol. Its IUPAC name is 2-methyl-4-phenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-methyl-4-phenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176842902 |
| Molecular Formula | C22H24BN3O2 |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-methyl-4-phenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | Cc1nc(-c2ccccc2)nc(-c2cccc(B3OC(C)(C)C(C)(C)O3)c2)n1 |
| InChI | InChI=1S/C22H24BN3O2/c1-15-24-19(16-10-7-6-8-11-16)26-20(25-15)17-12-9-13-18(14-17)23-27-21(2,3)22(4,5)28-23/h6-14H,1-5H3 |
| InChIKey | FFQNQIYVOLGFTP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|