C44H35BN4O2 — CID 168808429
4-[6-[4-phenyl-6-[3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]naphthalen-2-yl]benzonitrile (PubChem CID 168808429) has the molecular formula C44H35BN4O2 and a molecular weight of 662.60 g/mol. Its IUPAC name is 4-[6-[4-phenyl-6-[3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]naphthalen-2-yl]benzonitrile.
| Compound Name | 4-[6-[4-phenyl-6-[3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]naphthalen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 168808429 |
| Molecular Formula | C44H35BN4O2 |
| Molecular Weight | 662.60 g/mol |
| Exact Mass | 662.29 |
| IUPAC Name | 4-[6-[4-phenyl-6-[3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazin-2-yl]naphthalen-2-yl]benzonitrile |
| SMILES | CC1(C)OB(c2cc(-c3ccccc3)cc(-c3nc(-c4ccccc4)nc(-c4ccc5cc(-c6ccc(C#N)cc6)ccc5c4)n3)c2)OC1(C)C |
| InChI | InChI=1S/C44H35BN4O2/c1-43(2)44(3,4)51-45(50-43)39-26-37(30-11-7-5-8-12-30)25-38(27-39)42-48-40(32-13-9-6-10-14-32)47-41(49-42)36-22-21-34-23-33(19-20-35(34)24-36)31-17-15-29(28-46)16-18-31/h5-27H,1-4H3 |
| InChIKey | IMKUNNONHHDPEF-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.60 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|