C43H36N4 — CID 171574335
3-[4-(1-adamantyl)phenyl]-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 171574335) has the molecular formula C43H36N4 and a molecular weight of 608.79 g/mol. Its IUPAC name is 3-[4-(1-adamantyl)phenyl]-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 3-[4-(1-adamantyl)phenyl]-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 171574335 |
| Molecular Formula | C43H36N4 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | 3-[4-(1-adamantyl)phenyl]-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4cc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)ccc43)n2)cc1 |
| InChI | InChI=1S/C43H36N4/c1-3-9-32(10-4-1)40-44-41(33-11-5-2-6-12-33)46-42(45-40)47-38-14-8-7-13-36(38)37-24-34(17-20-39(37)47)31-15-18-35(19-16-31)43-25-28-21-29(26-43)23-30(22-28)27-43/h1-20,24,28-30H,21-23,25-27H2 |
| InChIKey | MCWJZVLTGGBHRA-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |