C55H44N4 — CID 169054901
2-[4-[4-(1-adamantyl)phenyl]-6-(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-9-phenylcarbazole (PubChem CID 169054901) has the molecular formula C55H44N4 and a molecular weight of 760.99 g/mol. Its IUPAC name is 2-[4-[4-(1-adamantyl)phenyl]-6-(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-9-phenylcarbazole.
| Compound Name | 2-[4-[4-(1-adamantyl)phenyl]-6-(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 169054901 |
| Molecular Formula | C55H44N4 |
| Molecular Weight | 760.99 g/mol |
| Exact Mass | 760.36 |
| IUPAC Name | 2-[4-[4-(1-adamantyl)phenyl]-6-(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-9-phenylcarbazole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3nc(-c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)nc(-c4ccc5c6ccccc6n(-c6ccccc6)c5c4)n3)c2)cc1 |
| InChI | InChI=1S/C55H44N4/c1-4-12-39(13-5-1)43-29-44(40-14-6-2-7-15-40)31-45(30-43)54-57-52(41-20-23-46(24-21-41)55-33-36-26-37(34-55)28-38(27-36)35-55)56-53(58-54)42-22-25-49-48-18-10-11-19-50(48)59(51(49)32-42)47-16-8-3-9-17-47/h1-25,29-32,36-38H,26-28,33-35H2 |
| InChIKey | VDJWMPXOVASHJR-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.99 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |