C37H32N4 — CID 171574370
9-[4-[4-(1-adamantyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]carbazole (PubChem CID 171574370) has the molecular formula C37H32N4 and a molecular weight of 532.69 g/mol. Its IUPAC name is 9-[4-[4-(1-adamantyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 9-[4-[4-(1-adamantyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 171574370 |
| Molecular Formula | C37H32N4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 9-[4-[4-(1-adamantyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)nc(-n3c4ccccc4c4ccccc43)n2)cc1 |
| InChI | InChI=1S/C37H32N4/c1-2-8-27(9-3-1)34-38-35(28-14-16-29(17-15-28)37-21-24-18-25(22-37)20-26(19-24)23-37)40-36(39-34)41-32-12-6-4-10-30(32)31-11-5-7-13-33(31)41/h1-17,24-26H,18-23H2 |
| InChIKey | HJFMTPHPZOUTRR-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |