C61H48N4 — CID 169054706
9-[4-(1-adamantyl)phenyl]-2-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]carbazole (PubChem CID 169054706) has the molecular formula C61H48N4 and a molecular weight of 837.08 g/mol. Its IUPAC name is 9-[4-(1-adamantyl)phenyl]-2-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 9-[4-(1-adamantyl)phenyl]-2-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 169054706 |
| Molecular Formula | C61H48N4 |
| Molecular Weight | 837.08 g/mol |
| Exact Mass | 836.39 |
| IUPAC Name | 9-[4-(1-adamantyl)phenyl]-2-[4-(3,5-diphenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]carbazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)nc(-c4ccc5c6ccccc6n(-c6ccc(C78CC9CC(CC(C9)C7)C8)cc6)c5c4)n3)cc2)cc1 |
| InChI | InChI=1S/C61H48N4/c1-4-12-43(13-5-1)46-20-22-47(23-21-46)58-62-59(64-60(63-58)51-34-49(44-14-6-2-7-15-44)33-50(35-51)45-16-8-3-9-17-45)48-24-29-55-54-18-10-11-19-56(54)65(57(55)36-48)53-27-25-52(26-28-53)61-37-40-30-41(38-61)32-42(31-40)39-61/h1-29,33-36,40-42H,30-32,37-39H2 |
| InChIKey | ZUOMENXRGIKINH-UHFFFAOYSA-N |
| XLogP | 15.44 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.08 |
| LogP ≤ 5 | 15.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |