C44H35N5 — CID 168808083
6-(1-adamantyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-(4-isocyanophenyl)carbazole (PubChem CID 168808083) has the molecular formula C44H35N5 and a molecular weight of 633.80 g/mol. Its IUPAC name is 6-(1-adamantyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-(4-isocyanophenyl)carbazole.
| Compound Name | 6-(1-adamantyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-(4-isocyanophenyl)carbazole |
|---|---|
| PubChem CID | 168808083 |
| Molecular Formula | C44H35N5 |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 633.29 |
| IUPAC Name | 6-(1-adamantyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-(4-isocyanophenyl)carbazole |
| SMILES | [C-]#[N+]c1ccc(-n2c3ccc(C45CC6CC(CC(C6)C4)C5)cc3c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc32)cc1 |
| InChI | InChI=1S/C44H35N5/c1-45-35-14-16-36(17-15-35)49-39-19-13-34(44-25-28-20-29(26-44)22-30(21-28)27-44)24-38(39)37-18-12-33(23-40(37)49)43-47-41(31-8-4-2-5-9-31)46-42(48-43)32-10-6-3-7-11-32/h2-19,23-24,28-30H,20-22,25-27H2 |
| InChIKey | CUJMTGTVKFVJQH-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|