C49H38N6 — CID 168808524
5-[4-[4-[4-(1-adamantyl)phenyl]phenyl]-6-[3-(4-isocyanophenyl)phenyl]-1,3,5-triazin-2-yl]pyrido[4,3-b]indole (PubChem CID 168808524) has the molecular formula C49H38N6 and a molecular weight of 710.89 g/mol. Its IUPAC name is 5-[4-[4-[4-(1-adamantyl)phenyl]phenyl]-6-[3-(4-isocyanophenyl)phenyl]-1,3,5-triazin-2-yl]pyrido[4,3-b]indole.
| Compound Name | 5-[4-[4-[4-(1-adamantyl)phenyl]phenyl]-6-[3-(4-isocyanophenyl)phenyl]-1,3,5-triazin-2-yl]pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 168808524 |
| Molecular Formula | C49H38N6 |
| Molecular Weight | 710.89 g/mol |
| Exact Mass | 710.32 |
| IUPAC Name | 5-[4-[4-[4-(1-adamantyl)phenyl]phenyl]-6-[3-(4-isocyanophenyl)phenyl]-1,3,5-triazin-2-yl]pyrido[4,3-b]indole |
| SMILES | [C-]#[N+]c1ccc(-c2cccc(-c3nc(-c4ccc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)cc4)nc(-n4c5ccccc5c5cnccc54)n3)c2)cc1 |
| InChI | InChI=1S/C49H38N6/c1-50-41-19-15-36(16-20-41)38-5-4-6-39(26-38)47-52-46(53-48(54-47)55-44-8-3-2-7-42(44)43-30-51-22-21-45(43)55)37-11-9-34(10-12-37)35-13-17-40(18-14-35)49-27-31-23-32(28-49)25-33(24-31)29-49/h2-22,26,30-33H,23-25,27-29H2 |
| InChIKey | MASUEDSJGNUTGZ-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 60.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.89 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|