C49H42N4 — CID 168808389
2-[7'-[4-(1-adamantyl)phenyl]spiro[cyclopentane-1,9'-fluorene]-2'-yl]-4-(4-isocyanophenyl)-6-phenyl-1,3,5-triazine (PubChem CID 168808389) has the molecular formula C49H42N4 and a molecular weight of 686.90 g/mol. Its IUPAC name is 2-[7'-[4-(1-adamantyl)phenyl]spiro[cyclopentane-1,9'-fluorene]-2'-yl]-4-(4-isocyanophenyl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[7'-[4-(1-adamantyl)phenyl]spiro[cyclopentane-1,9'-fluorene]-2'-yl]-4-(4-isocyanophenyl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168808389 |
| Molecular Formula | C49H42N4 |
| Molecular Weight | 686.90 g/mol |
| Exact Mass | 686.34 |
| IUPAC Name | 2-[7'-[4-(1-adamantyl)phenyl]spiro[cyclopentane-1,9'-fluorene]-2'-yl]-4-(4-isocyanophenyl)-6-phenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)C3(CCCC3)c3cc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)ccc3-4)n2)cc1 |
| InChI | InChI=1S/C49H42N4/c1-50-40-17-11-36(12-18-40)46-51-45(35-7-3-2-4-8-35)52-47(53-46)38-14-20-42-41-19-13-37(26-43(41)49(44(42)27-38)21-5-6-22-49)34-9-15-39(16-10-34)48-28-31-23-32(29-48)25-33(24-31)30-48/h2-4,7-20,26-27,31-33H,5-6,21-25,28-30H2 |
| InChIKey | OZWBWBIBYKYAJH-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.90 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|