C46H34N4 — CID 171440408
2-[4-[3-(7'-isocyanospiro[cyclohexane-1,9'-fluorene]-2'-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 171440408) has the molecular formula C46H34N4 and a molecular weight of 642.81 g/mol. Its IUPAC name is 2-[4-[3-(7'-isocyanospiro[cyclohexane-1,9'-fluorene]-2'-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[3-(7'-isocyanospiro[cyclohexane-1,9'-fluorene]-2'-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 171440408 |
| Molecular Formula | C46H34N4 |
| Molecular Weight | 642.81 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | 2-[4-[3-(7'-isocyanospiro[cyclohexane-1,9'-fluorene]-2'-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc2c(c1)C1(CCCCC1)c1cc(-c3cccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c3)ccc1-2 |
| InChI | InChI=1S/C46H34N4/c1-47-38-23-25-40-39-24-22-37(29-41(39)46(42(40)30-38)26-9-4-10-27-46)36-17-11-16-35(28-36)31-18-20-34(21-19-31)45-49-43(32-12-5-2-6-13-32)48-44(50-45)33-14-7-3-8-15-33/h2-3,5-8,11-25,28-30H,4,9-10,26-27H2 |
| InChIKey | PRYYBLLPSQWKHO-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.81 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|