C58H40N4O — CID 171440389
2-dibenzofuran-2-yl-4-[4-[4-(6'-isocyanospiro[cyclohexane-1,9'-fluorene]-2'-yl)phenyl]phenyl]-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 171440389) has the molecular formula C58H40N4O and a molecular weight of 808.99 g/mol. Its IUPAC name is 2-dibenzofuran-2-yl-4-[4-[4-(6'-isocyanospiro[cyclohexane-1,9'-fluorene]-2'-yl)phenyl]phenyl]-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-2-yl-4-[4-[4-(6'-isocyanospiro[cyclohexane-1,9'-fluorene]-2'-yl)phenyl]phenyl]-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171440389 |
| Molecular Formula | C58H40N4O |
| Molecular Weight | 808.99 g/mol |
| Exact Mass | 808.32 |
| IUPAC Name | 2-dibenzofuran-2-yl-4-[4-[4-(6'-isocyanospiro[cyclohexane-1,9'-fluorene]-2'-yl)phenyl]phenyl]-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc2c(c1)-c1ccc(-c3ccc(-c4ccc(-c5nc(-c6ccc(-c7ccccc7)cc6)nc(-c6ccc7oc8ccccc8c7c6)n5)cc4)cc3)cc1C21CCCCC1 |
| InChI | InChI=1S/C58H40N4O/c1-59-46-28-30-51-49(36-46)47-29-26-44(35-52(47)58(51)32-8-3-9-33-58)41-16-14-39(15-17-41)40-20-24-43(25-21-40)56-60-55(42-22-18-38(19-23-42)37-10-4-2-5-11-37)61-57(62-56)45-27-31-54-50(34-45)48-12-6-7-13-53(48)63-54/h2,4-7,10-31,34-36H,3,8-9,32-33H2 |
| InChIKey | QYLIXYATBXPSAC-UHFFFAOYSA-N |
| XLogP | 15.55 |
| TPSA | 56.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.99 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|