C52H38N4 — CID 171441013
2-[4-[3-[3-(7'-isocyanospiro[cyclohexane-1,9'-fluorene]-2'-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 171441013) has the molecular formula C52H38N4 and a molecular weight of 718.90 g/mol. Its IUPAC name is 2-[4-[3-[3-(7'-isocyanospiro[cyclohexane-1,9'-fluorene]-2'-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[3-[3-(7'-isocyanospiro[cyclohexane-1,9'-fluorene]-2'-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 171441013 |
| Molecular Formula | C52H38N4 |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | 2-[4-[3-[3-(7'-isocyanospiro[cyclohexane-1,9'-fluorene]-2'-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc2c(c1)C1(CCCCC1)c1cc(-c3cccc(-c4cccc(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)c4)c3)ccc1-2 |
| InChI | InChI=1S/C52H38N4/c1-53-44-26-28-46-45-27-25-43(33-47(45)52(48(46)34-44)29-9-4-10-30-52)42-20-12-19-41(32-42)40-18-11-17-39(31-40)35-21-23-38(24-22-35)51-55-49(36-13-5-2-6-14-36)54-50(56-51)37-15-7-3-8-16-37/h2-3,5-8,11-28,31-34H,4,9-10,29-30H2 |
| InChIKey | WKGGUETUUMXCTE-UHFFFAOYSA-N |
| XLogP | 13.65 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|