C44H34N6 — CID 168808000
4-[4-[4-[3-[4-(1-adamantyl)phenyl]phenyl]-6-(4-isocyanophenyl)-1,3,5-triazin-2-yl]phenyl]pyridine-3-carbonitrile (PubChem CID 168808000) has the molecular formula C44H34N6 and a molecular weight of 646.80 g/mol. Its IUPAC name is 4-[4-[4-[3-[4-(1-adamantyl)phenyl]phenyl]-6-(4-isocyanophenyl)-1,3,5-triazin-2-yl]phenyl]pyridine-3-carbonitrile.
| Compound Name | 4-[4-[4-[3-[4-(1-adamantyl)phenyl]phenyl]-6-(4-isocyanophenyl)-1,3,5-triazin-2-yl]phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168808000 |
| Molecular Formula | C44H34N6 |
| Molecular Weight | 646.80 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | 4-[4-[4-[3-[4-(1-adamantyl)phenyl]phenyl]-6-(4-isocyanophenyl)-1,3,5-triazin-2-yl]phenyl]pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3ccc(-c4ccncc4C#N)cc3)nc(-c3cccc(-c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)c3)n2)cc1 |
| InChI | InChI=1S/C44H34N6/c1-46-39-15-11-34(12-16-39)42-48-41(33-7-5-32(6-8-33)40-17-18-47-27-37(40)26-45)49-43(50-42)36-4-2-3-35(22-36)31-9-13-38(14-10-31)44-23-28-19-29(24-44)21-30(20-28)25-44/h2-18,22,27-30H,19-21,23-25H2 |
| InChIKey | BPRMVRYAMJUSLN-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 79.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.80 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|