C60H54N4 — CID 168808054
4-[4-[4,6-bis[3-[4-(1-adamantyl)phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 168808054) has the molecular formula C60H54N4 and a molecular weight of 831.12 g/mol. Its IUPAC name is 4-[4-[4,6-bis[3-[4-(1-adamantyl)phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[4,6-bis[3-[4-(1-adamantyl)phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 168808054 |
| Molecular Formula | C60H54N4 |
| Molecular Weight | 831.12 g/mol |
| Exact Mass | 830.43 |
| IUPAC Name | 4-[4-[4,6-bis[3-[4-(1-adamantyl)phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3nc(-c4cccc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)c4)nc(-c4cccc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C60H54N4/c61-37-38-7-9-45(10-8-38)46-11-13-49(14-12-46)56-62-57(52-5-1-3-50(29-52)47-15-19-54(20-16-47)59-31-39-23-40(32-59)25-41(24-39)33-59)64-58(63-56)53-6-2-4-51(30-53)48-17-21-55(22-18-48)60-34-42-26-43(35-60)28-44(27-42)36-60/h1-22,29-30,39-44H,23-28,31-36H2 |
| InChIKey | FASIESHZBYHGHZ-UHFFFAOYSA-N |
| XLogP | 14.68 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.12 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |