C44H36N4 — CID 168808497
4-[5-[4-[4-(1-adamantyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-2-phenylphenyl]benzonitrile (PubChem CID 168808497) has the molecular formula C44H36N4 and a molecular weight of 620.80 g/mol. Its IUPAC name is 4-[5-[4-[4-(1-adamantyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-2-phenylphenyl]benzonitrile.
| Compound Name | 4-[5-[4-[4-(1-adamantyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-2-phenylphenyl]benzonitrile |
|---|---|
| PubChem CID | 168808497 |
| Molecular Formula | C44H36N4 |
| Molecular Weight | 620.80 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | 4-[5-[4-[4-(1-adamantyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-2-phenylphenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)n3)ccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C44H36N4/c45-28-29-11-13-34(14-12-29)40-24-37(17-20-39(40)33-7-3-1-4-8-33)43-47-41(35-9-5-2-6-10-35)46-42(48-43)36-15-18-38(19-16-36)44-25-30-21-31(26-44)23-32(22-30)27-44/h1-20,24,30-32H,21-23,25-27H2 |
| InChIKey | BPVFZAPHDZZCPI-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.80 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |