C48H46N4 — CID 168807913
4-[4-[4-[2,4-bis(1-adamantyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 168807913) has the molecular formula C48H46N4 and a molecular weight of 678.92 g/mol. Its IUPAC name is 4-[4-[4-[2,4-bis(1-adamantyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[4-[2,4-bis(1-adamantyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 168807913 |
| Molecular Formula | C48H46N4 |
| Molecular Weight | 678.92 g/mol |
| Exact Mass | 678.37 |
| IUPAC Name | 4-[4-[4-[2,4-bis(1-adamantyl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(C56CC7CC(CC(C7)C5)C6)cc4C45CC6CC(CC(C6)C4)C5)n3)cc2)cc1 |
| InChI | InChI=1S/C48H46N4/c49-29-30-6-8-37(9-7-30)38-10-12-40(13-11-38)45-50-44(39-4-2-1-3-5-39)51-46(52-45)42-15-14-41(47-23-31-16-32(24-47)18-33(17-31)25-47)22-43(42)48-26-34-19-35(27-48)21-36(20-34)28-48/h1-15,22,31-36H,16-21,23-28H2 |
| InChIKey | VEFFWNIRGFPHNK-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.92 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |