C46H36N4 — CID 168808224
2-[9-[4-(1-adamantyl)phenyl]phenanthren-3-yl]-4-(4-isocyanophenyl)-6-phenyl-1,3,5-triazine (PubChem CID 168808224) has the molecular formula C46H36N4 and a molecular weight of 644.82 g/mol. Its IUPAC name is 2-[9-[4-(1-adamantyl)phenyl]phenanthren-3-yl]-4-(4-isocyanophenyl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[9-[4-(1-adamantyl)phenyl]phenanthren-3-yl]-4-(4-isocyanophenyl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168808224 |
| Molecular Formula | C46H36N4 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | 2-[9-[4-(1-adamantyl)phenyl]phenanthren-3-yl]-4-(4-isocyanophenyl)-6-phenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4cc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)c5ccccc5c4c3)n2)cc1 |
| InChI | InChI=1S/C46H36N4/c1-47-38-19-15-34(16-20-38)44-48-43(33-7-3-2-4-8-33)49-45(50-44)36-12-11-35-24-41(39-9-5-6-10-40(39)42(35)25-36)32-13-17-37(18-14-32)46-26-29-21-30(27-46)23-31(22-29)28-46/h2-20,24-25,29-31H,21-23,26-28H2 |
| InChIKey | QYCRNSNCKPKTMX-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|