C52H40N4 — CID 168808603
2-[3-[4-(1-adamantyl)phenyl]-5-phenylphenyl]-4-(5-isocyanonaphthalen-1-yl)-6-naphthalen-2-yl-1,3,5-triazine (PubChem CID 168808603) has the molecular formula C52H40N4 and a molecular weight of 720.92 g/mol. Its IUPAC name is 2-[3-[4-(1-adamantyl)phenyl]-5-phenylphenyl]-4-(5-isocyanonaphthalen-1-yl)-6-naphthalen-2-yl-1,3,5-triazine.
| Compound Name | 2-[3-[4-(1-adamantyl)phenyl]-5-phenylphenyl]-4-(5-isocyanonaphthalen-1-yl)-6-naphthalen-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 168808603 |
| Molecular Formula | C52H40N4 |
| Molecular Weight | 720.92 g/mol |
| Exact Mass | 720.33 |
| IUPAC Name | 2-[3-[4-(1-adamantyl)phenyl]-5-phenylphenyl]-4-(5-isocyanonaphthalen-1-yl)-6-naphthalen-2-yl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1cccc2c(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)c4)nc(-c4ccc5ccccc5c4)n3)cccc12 |
| InChI | InChI=1S/C52H40N4/c1-53-48-16-8-13-45-46(48)14-7-15-47(45)51-55-49(40-18-17-37-11-5-6-12-39(37)26-40)54-50(56-51)43-28-41(36-9-3-2-4-10-36)27-42(29-43)38-19-21-44(22-20-38)52-30-33-23-34(31-52)25-35(24-33)32-52/h2-22,26-29,33-35H,23-25,30-32H2 |
| InChIKey | RQPRGVPUSQGMST-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.92 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|