C58H44N4 — CID 168807999
2-[10-[4-(1-adamantyl)phenyl]anthracen-9-yl]-4-(3,5-diphenylphenyl)-6-(4-isocyanophenyl)-1,3,5-triazine (PubChem CID 168807999) has the molecular formula C58H44N4 and a molecular weight of 797.02 g/mol. Its IUPAC name is 2-[10-[4-(1-adamantyl)phenyl]anthracen-9-yl]-4-(3,5-diphenylphenyl)-6-(4-isocyanophenyl)-1,3,5-triazine.
| Compound Name | 2-[10-[4-(1-adamantyl)phenyl]anthracen-9-yl]-4-(3,5-diphenylphenyl)-6-(4-isocyanophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168807999 |
| Molecular Formula | C58H44N4 |
| Molecular Weight | 797.02 g/mol |
| Exact Mass | 796.36 |
| IUPAC Name | 2-[10-[4-(1-adamantyl)phenyl]anthracen-9-yl]-4-(3,5-diphenylphenyl)-6-(4-isocyanophenyl)-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)nc(-c3c4ccccc4c(-c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C58H44N4/c1-59-48-26-22-43(23-27-48)55-60-56(46-32-44(40-12-4-2-5-13-40)31-45(33-46)41-14-6-3-7-15-41)62-57(61-55)54-51-18-10-8-16-49(51)53(50-17-9-11-19-52(50)54)42-20-24-47(25-21-42)58-34-37-28-38(35-58)30-39(29-37)36-58/h2-27,31-33,37-39H,28-30,34-36H2 |
| InChIKey | MPUJNUSVUOEPNV-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.02 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|