C43H33N5 — CID 168808115
2-[4-[4-(1-adamantyl)naphthalen-1-yl]phenyl]-4,6-bis(4-isocyanophenyl)-1,3,5-triazine (PubChem CID 168808115) has the molecular formula C43H33N5 and a molecular weight of 619.77 g/mol. Its IUPAC name is 2-[4-[4-(1-adamantyl)naphthalen-1-yl]phenyl]-4,6-bis(4-isocyanophenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[4-(1-adamantyl)naphthalen-1-yl]phenyl]-4,6-bis(4-isocyanophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168808115 |
| Molecular Formula | C43H33N5 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | 2-[4-[4-(1-adamantyl)naphthalen-1-yl]phenyl]-4,6-bis(4-isocyanophenyl)-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3ccc([N+]#[C-])cc3)nc(-c3ccc(-c4ccc(C56CC7CC(CC(C7)C5)C6)c5ccccc45)cc3)n2)cc1 |
| InChI | InChI=1S/C43H33N5/c1-44-34-15-11-32(12-16-34)41-46-40(47-42(48-41)33-13-17-35(45-2)18-14-33)31-9-7-30(8-10-31)36-19-20-39(38-6-4-3-5-37(36)38)43-24-27-21-28(25-43)23-29(22-27)26-43/h3-20,27-29H,21-26H2 |
| InChIKey | PEKXVJNIDYDGMG-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 47.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|