C44H36N4O — CID 176872066
7-(1-adamantyl)-4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,3-benzoxazole (PubChem CID 176872066) has the molecular formula C44H36N4O and a molecular weight of 636.80 g/mol. Its IUPAC name is 7-(1-adamantyl)-4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,3-benzoxazole.
| Compound Name | 7-(1-adamantyl)-4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 176872066 |
| Molecular Formula | C44H36N4O |
| Molecular Weight | 636.80 g/mol |
| Exact Mass | 636.29 |
| IUPAC Name | 7-(1-adamantyl)-4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc(-c5ccc(C67CC8CC(CC(C8)C6)C7)c6ocnc56)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C44H36N4O/c1-3-7-34(8-4-1)41-46-42(35-9-5-2-6-10-35)48-43(47-41)36-17-13-32(14-18-36)31-11-15-33(16-12-31)37-19-20-38(40-39(37)45-27-49-40)44-24-28-21-29(25-44)23-30(22-28)26-44/h1-20,27-30H,21-26H2 |
| InChIKey | BSEMHYGIHCTUPW-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.80 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |