C45H37N3O — CID 176872063
7-[3-(1-adamantyl)phenyl]-4-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-1,3-benzoxazole (PubChem CID 176872063) has the molecular formula C45H37N3O and a molecular weight of 635.81 g/mol. Its IUPAC name is 7-[3-(1-adamantyl)phenyl]-4-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-1,3-benzoxazole.
| Compound Name | 7-[3-(1-adamantyl)phenyl]-4-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 176872063 |
| Molecular Formula | C45H37N3O |
| Molecular Weight | 635.81 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | 7-[3-(1-adamantyl)phenyl]-4-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2cc(-c3cccc(-c4ccc(-c5cccc(C67CC8CC(CC(C8)C6)C7)c5)c5ocnc45)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C45H37N3O/c1-3-9-32(10-4-1)40-24-41(48-44(47-40)33-11-5-2-6-12-33)36-15-7-13-34(22-36)38-17-18-39(43-42(38)46-28-49-43)35-14-8-16-37(23-35)45-25-29-19-30(26-45)21-31(20-29)27-45/h1-18,22-24,28-31H,19-21,25-27H2 |
| InChIKey | YQALOVWZBRAXEA-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.81 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |