C39H33N3O — CID 176871999
4-(1-adamantyl)-7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-1,3-benzoxazole (PubChem CID 176871999) has the molecular formula C39H33N3O and a molecular weight of 559.71 g/mol. Its IUPAC name is 4-(1-adamantyl)-7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-1,3-benzoxazole.
| Compound Name | 4-(1-adamantyl)-7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 176871999 |
| Molecular Formula | C39H33N3O |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | 4-(1-adamantyl)-7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ccc(C56CC7CC(CC(C7)C5)C6)c5ncoc45)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C39H33N3O/c1-3-7-29(8-4-1)34-20-35(42-38(41-34)31-9-5-2-6-10-31)30-13-11-28(12-14-30)32-15-16-33(36-37(32)43-24-40-36)39-21-25-17-26(22-39)19-27(18-25)23-39/h1-16,20,24-27H,17-19,21-23H2 |
| InChIKey | INTRBKIZGRIZHO-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |