C42H34N4O — CID 176872031
4-(1-adamantyl)-7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-1,3-benzoxazole (PubChem CID 176872031) has the molecular formula C42H34N4O and a molecular weight of 610.76 g/mol. Its IUPAC name is 4-(1-adamantyl)-7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-1,3-benzoxazole.
| Compound Name | 4-(1-adamantyl)-7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 176872031 |
| Molecular Formula | C42H34N4O |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | 4-(1-adamantyl)-7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc(C56CC7CC(CC(C7)C5)C6)c5ncoc45)c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C42H34N4O/c1-3-9-29(10-4-1)39-44-40(30-11-5-2-6-12-30)46-41(45-39)35-16-15-33(31-13-7-8-14-32(31)35)34-17-18-36(37-38(34)47-25-43-37)42-22-26-19-27(23-42)21-28(20-26)24-42/h1-18,25-28H,19-24H2 |
| InChIKey | QPGAANZFEJJUQY-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |