C43H35N3O — CID 176871981
4-(1-adamantyl)-7-[4-(2,6-diphenylpyrimidin-4-yl)naphthalen-1-yl]-1,3-benzoxazole (PubChem CID 176871981) has the molecular formula C43H35N3O and a molecular weight of 609.77 g/mol. Its IUPAC name is 4-(1-adamantyl)-7-[4-(2,6-diphenylpyrimidin-4-yl)naphthalen-1-yl]-1,3-benzoxazole.
| Compound Name | 4-(1-adamantyl)-7-[4-(2,6-diphenylpyrimidin-4-yl)naphthalen-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 176871981 |
| Molecular Formula | C43H35N3O |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | 4-(1-adamantyl)-7-[4-(2,6-diphenylpyrimidin-4-yl)naphthalen-1-yl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ccc(C56CC7CC(CC(C7)C5)C6)c5ncoc45)c4ccccc34)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C43H35N3O/c1-3-9-30(10-4-1)38-22-39(46-42(45-38)31-11-5-2-6-12-31)35-16-15-34(32-13-7-8-14-33(32)35)36-17-18-37(40-41(36)47-26-44-40)43-23-27-19-28(24-43)21-29(20-27)25-43/h1-18,22,26-29H,19-21,23-25H2 |
| InChIKey | FCCQQMVXZXGLAC-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |