C51H50N4O — CID 176871919
7-[4-[4,6-bis(1-adamantyl)-1,3,5-triazin-2-yl]phenyl]-4-(9,9-dimethylfluoren-2-yl)-1,3-benzoxazole (PubChem CID 176871919) has the molecular formula C51H50N4O and a molecular weight of 734.99 g/mol. Its IUPAC name is 7-[4-[4,6-bis(1-adamantyl)-1,3,5-triazin-2-yl]phenyl]-4-(9,9-dimethylfluoren-2-yl)-1,3-benzoxazole.
| Compound Name | 7-[4-[4,6-bis(1-adamantyl)-1,3,5-triazin-2-yl]phenyl]-4-(9,9-dimethylfluoren-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 176871919 |
| Molecular Formula | C51H50N4O |
| Molecular Weight | 734.99 g/mol |
| Exact Mass | 734.40 |
| IUPAC Name | 7-[4-[4,6-bis(1-adamantyl)-1,3,5-triazin-2-yl]phenyl]-4-(9,9-dimethylfluoren-2-yl)-1,3-benzoxazole |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(-c4ccc(-c5nc(C67CC8CC(CC(C8)C6)C7)nc(C67CC8CC(CC(C8)C6)C7)n5)cc4)c4ocnc34)cc21 |
| InChI | InChI=1S/C51H50N4O/c1-49(2)42-6-4-3-5-40(42)41-12-11-37(21-43(41)49)38-13-14-39(45-44(38)52-28-56-45)35-7-9-36(10-8-35)46-53-47(50-22-29-15-30(23-50)17-31(16-29)24-50)55-48(54-46)51-25-32-18-33(26-51)20-34(19-32)27-51/h3-14,21,28-34H,15-20,22-27H2,1-2H3 |
| InChIKey | DISYSECQKHIGRW-UHFFFAOYSA-N |
| XLogP | 12.26 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.99 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |