C58H55N3O — CID 176871852
7-[2,6-bis[4-(1-adamantyl)phenyl]pyrimidin-4-yl]-4-(9,9-dimethylfluoren-2-yl)-1,3-benzoxazole (PubChem CID 176871852) has the molecular formula C58H55N3O and a molecular weight of 810.10 g/mol. Its IUPAC name is 7-[2,6-bis[4-(1-adamantyl)phenyl]pyrimidin-4-yl]-4-(9,9-dimethylfluoren-2-yl)-1,3-benzoxazole.
| Compound Name | 7-[2,6-bis[4-(1-adamantyl)phenyl]pyrimidin-4-yl]-4-(9,9-dimethylfluoren-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 176871852 |
| Molecular Formula | C58H55N3O |
| Molecular Weight | 810.10 g/mol |
| Exact Mass | 809.43 |
| IUPAC Name | 7-[2,6-bis[4-(1-adamantyl)phenyl]pyrimidin-4-yl]-4-(9,9-dimethylfluoren-2-yl)-1,3-benzoxazole |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(-c4cc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)nc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)n4)c4ocnc34)cc21 |
| InChI | InChI=1S/C58H55N3O/c1-56(2)49-6-4-3-5-46(49)47-16-11-42(25-50(47)56)45-17-18-48(54-53(45)59-33-62-54)52-26-51(40-7-12-43(13-8-40)57-27-34-19-35(28-57)21-36(20-34)29-57)60-55(61-52)41-9-14-44(15-10-41)58-30-37-22-38(31-58)24-39(23-37)32-58/h3-18,25-26,33-39H,19-24,27-32H2,1-2H3 |
| InChIKey | ZQBJEYMKLJQXFA-UHFFFAOYSA-N |
| XLogP | 14.53 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.10 |
| LogP ≤ 5 | 14.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |