C46H36N2O2 — CID 176871913
7-[7-(1-adamantyl)dibenzofuran-3-yl]-4-(2,6-diphenyl-4-pyridinyl)-1,3-benzoxazole (PubChem CID 176871913) has the molecular formula C46H36N2O2 and a molecular weight of 648.81 g/mol. Its IUPAC name is 7-[7-(1-adamantyl)dibenzofuran-3-yl]-4-(2,6-diphenyl-4-pyridinyl)-1,3-benzoxazole.
| Compound Name | 7-[7-(1-adamantyl)dibenzofuran-3-yl]-4-(2,6-diphenyl-4-pyridinyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 176871913 |
| Molecular Formula | C46H36N2O2 |
| Molecular Weight | 648.81 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | 7-[7-(1-adamantyl)dibenzofuran-3-yl]-4-(2,6-diphenyl-4-pyridinyl)-1,3-benzoxazole |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ccc5c(c4)oc4cc(C67CC8CC(CC(C8)C6)C7)ccc45)c4ocnc34)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C46H36N2O2/c1-3-7-31(8-4-1)40-20-34(21-41(48-40)32-9-5-2-6-10-32)36-15-16-37(45-44(36)47-27-49-45)33-11-13-38-39-14-12-35(23-43(39)50-42(38)22-33)46-24-28-17-29(25-46)19-30(18-28)26-46/h1-16,20-23,27-30H,17-19,24-26H2 |
| InChIKey | ZQISZHMREIPWAA-UHFFFAOYSA-N |
| XLogP | 12.26 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.81 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |