C61H45N3O2 — CID 169055032
2-[6-[6-[4-(1-adamantyl)phenyl]dibenzofuran-3-yl]dibenzofuran-3-yl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine (PubChem CID 169055032) has the molecular formula C61H45N3O2 and a molecular weight of 852.05 g/mol. Its IUPAC name is 2-[6-[6-[4-(1-adamantyl)phenyl]dibenzofuran-3-yl]dibenzofuran-3-yl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[6-[6-[4-(1-adamantyl)phenyl]dibenzofuran-3-yl]dibenzofuran-3-yl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 169055032 |
| Molecular Formula | C61H45N3O2 |
| Molecular Weight | 852.05 g/mol |
| Exact Mass | 851.35 |
| IUPAC Name | 2-[6-[6-[4-(1-adamantyl)phenyl]dibenzofuran-3-yl]dibenzofuran-3-yl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccc4c(c3)oc3c(-c5ccc6c(c5)oc5c(-c7ccc(C89CC%10CC(CC(C%10)C8)C9)cc7)cccc56)cccc34)nc(-c3ccccc3-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C61H45N3O2/c1-3-11-40(12-4-1)46-15-7-8-16-53(46)60-63-58(42-13-5-2-6-14-42)62-59(64-60)44-24-28-50-52-20-10-18-48(57(52)66-55(50)33-44)43-23-27-49-51-19-9-17-47(56(51)65-54(49)32-43)41-21-25-45(26-22-41)61-34-37-29-38(35-61)31-39(30-37)36-61/h1-28,32-33,37-39H,29-31,34-36H2 |
| InChIKey | QRGDLIJPTYVXEB-UHFFFAOYSA-N |
| XLogP | 16.14 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.05 |
| LogP ≤ 5 | 16.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |