C63H63N3O — CID 169055138
2,4-bis[4-(1-adamantyl)phenyl]-6-[7-[4-(1-adamantyl)phenyl]dibenzofuran-4-yl]-1,3,5-triazine (PubChem CID 169055138) has the molecular formula C63H63N3O and a molecular weight of 878.22 g/mol. Its IUPAC name is 2,4-bis[4-(1-adamantyl)phenyl]-6-[7-[4-(1-adamantyl)phenyl]dibenzofuran-4-yl]-1,3,5-triazine.
| Compound Name | 2,4-bis[4-(1-adamantyl)phenyl]-6-[7-[4-(1-adamantyl)phenyl]dibenzofuran-4-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 169055138 |
| Molecular Formula | C63H63N3O |
| Molecular Weight | 878.22 g/mol |
| Exact Mass | 877.50 |
| IUPAC Name | 2,4-bis[4-(1-adamantyl)phenyl]-6-[7-[4-(1-adamantyl)phenyl]dibenzofuran-4-yl]-1,3,5-triazine |
| SMILES | c1cc(-c2nc(-c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)nc(-c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)n2)c2oc3cc(-c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)ccc3c2c1 |
| InChI | InChI=1S/C63H63N3O/c1-2-54-53-17-10-49(46-4-11-50(12-5-46)61-28-37-18-38(29-61)20-39(19-37)30-61)27-56(53)67-57(54)55(3-1)60-65-58(47-6-13-51(14-7-47)62-31-40-21-41(32-62)23-42(22-40)33-62)64-59(66-60)48-8-15-52(16-9-48)63-34-43-24-44(35-63)26-45(25-43)36-63/h1-17,27,37-45H,18-26,28-36H2 |
| InChIKey | RIZNAAUTKYILMG-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.22 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |