C55H43N3O — CID 164798019
2-[4-(1-adamantyl)phenyl]-4-(4-phenylphenyl)-6-[9-(4-phenylphenyl)dibenzofuran-3-yl]-1,3,5-triazine (PubChem CID 164798019) has the molecular formula C55H43N3O and a molecular weight of 761.97 g/mol. Its IUPAC name is 2-[4-(1-adamantyl)phenyl]-4-(4-phenylphenyl)-6-[9-(4-phenylphenyl)dibenzofuran-3-yl]-1,3,5-triazine.
| Compound Name | 2-[4-(1-adamantyl)phenyl]-4-(4-phenylphenyl)-6-[9-(4-phenylphenyl)dibenzofuran-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 164798019 |
| Molecular Formula | C55H43N3O |
| Molecular Weight | 761.97 g/mol |
| Exact Mass | 761.34 |
| IUPAC Name | 2-[4-(1-adamantyl)phenyl]-4-(4-phenylphenyl)-6-[9-(4-phenylphenyl)dibenzofuran-3-yl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)nc(-c4ccc5c(c4)oc4cccc(-c6ccc(-c7ccccc7)cc6)c45)n3)cc2)cc1 |
| InChI | InChI=1S/C55H43N3O/c1-3-8-38(9-4-1)40-14-18-42(19-15-40)47-12-7-13-49-51(47)48-27-24-45(31-50(48)59-49)54-57-52(43-20-16-41(17-21-43)39-10-5-2-6-11-39)56-53(58-54)44-22-25-46(26-23-44)55-32-35-28-36(33-55)30-37(29-35)34-55/h1-27,31,35-37H,28-30,32-34H2 |
| InChIKey | RQYJNQIKQNMZID-UHFFFAOYSA-N |
| XLogP | 14.24 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.97 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |