C66H48N4O2 — CID 169054639
2-[3-[4-(1-adamantyl)phenyl]-5-pyridin-4-ylphenyl]-4-dibenzofuran-4-yl-6-(2,8-diphenyldibenzofuran-4-yl)-1,3,5-triazine (PubChem CID 169054639) has the molecular formula C66H48N4O2 and a molecular weight of 929.14 g/mol. Its IUPAC name is 2-[3-[4-(1-adamantyl)phenyl]-5-pyridin-4-ylphenyl]-4-dibenzofuran-4-yl-6-(2,8-diphenyldibenzofuran-4-yl)-1,3,5-triazine.
| Compound Name | 2-[3-[4-(1-adamantyl)phenyl]-5-pyridin-4-ylphenyl]-4-dibenzofuran-4-yl-6-(2,8-diphenyldibenzofuran-4-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 169054639 |
| Molecular Formula | C66H48N4O2 |
| Molecular Weight | 929.14 g/mol |
| Exact Mass | 928.38 |
| IUPAC Name | 2-[3-[4-(1-adamantyl)phenyl]-5-pyridin-4-ylphenyl]-4-dibenzofuran-4-yl-6-(2,8-diphenyldibenzofuran-4-yl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc3oc4c(-c5nc(-c6cc(-c7ccncc7)cc(-c7ccc(C89CC%10CC(CC(C%10)C8)C9)cc7)c6)nc(-c6cccc7c6oc6ccccc67)n5)cc(-c5ccccc5)cc4c3c2)cc1 |
| InChI | InChI=1S/C66H48N4O2/c1-3-10-43(11-4-1)47-20-23-60-56(34-47)57-35-50(44-12-5-2-6-13-44)36-58(62(57)72-60)65-69-63(68-64(70-65)55-16-9-15-54-53-14-7-8-17-59(53)71-61(54)55)51-32-48(31-49(33-51)46-24-26-67-27-25-46)45-18-21-52(22-19-45)66-37-40-28-41(38-66)30-42(29-40)39-66/h1-27,31-36,40-42H,28-30,37-39H2 |
| InChIKey | JTGWIXCHRBATBD-UHFFFAOYSA-N |
| XLogP | 17.20 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.14 |
| LogP ≤ 5 | 17.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |