C56H44N2O — CID 169054724
4-[4-(1-adamantyl)phenyl]-6-(4,8-diphenyldibenzofuran-2-yl)-2-(4-phenylphenyl)pyrimidine (PubChem CID 169054724) has the molecular formula C56H44N2O and a molecular weight of 760.98 g/mol. Its IUPAC name is 4-[4-(1-adamantyl)phenyl]-6-(4,8-diphenyldibenzofuran-2-yl)-2-(4-phenylphenyl)pyrimidine.
| Compound Name | 4-[4-(1-adamantyl)phenyl]-6-(4,8-diphenyldibenzofuran-2-yl)-2-(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 169054724 |
| Molecular Formula | C56H44N2O |
| Molecular Weight | 760.98 g/mol |
| Exact Mass | 760.35 |
| IUPAC Name | 4-[4-(1-adamantyl)phenyl]-6-(4,8-diphenyldibenzofuran-2-yl)-2-(4-phenylphenyl)pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)cc(-c4cc(-c5ccccc5)c5oc6ccc(-c7ccccc7)cc6c5c4)n3)cc2)cc1 |
| InChI | InChI=1S/C56H44N2O/c1-4-10-39(11-5-1)41-16-18-44(19-17-41)55-57-51(43-20-23-47(24-21-43)56-33-36-26-37(34-56)28-38(27-36)35-56)32-52(58-55)46-30-48(42-14-8-3-9-15-42)54-50(31-46)49-29-45(22-25-53(49)59-54)40-12-6-2-7-13-40/h1-25,29-32,36-38H,26-28,33-35H2 |
| InChIKey | QLGJFBMQCWEZBN-UHFFFAOYSA-N |
| XLogP | 14.85 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.98 |
| LogP ≤ 5 | 14.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |