C51H39N3O — CID 168808033
4-[3-[4-(1-adamantyl)phenyl]-5-dibenzofuran-4-ylphenyl]-6-(3-isocyanophenyl)-2-phenylpyrimidine (PubChem CID 168808033) has the molecular formula C51H39N3O and a molecular weight of 709.89 g/mol. Its IUPAC name is 4-[3-[4-(1-adamantyl)phenyl]-5-dibenzofuran-4-ylphenyl]-6-(3-isocyanophenyl)-2-phenylpyrimidine.
| Compound Name | 4-[3-[4-(1-adamantyl)phenyl]-5-dibenzofuran-4-ylphenyl]-6-(3-isocyanophenyl)-2-phenylpyrimidine |
|---|---|
| PubChem CID | 168808033 |
| Molecular Formula | C51H39N3O |
| Molecular Weight | 709.89 g/mol |
| Exact Mass | 709.31 |
| IUPAC Name | 4-[3-[4-(1-adamantyl)phenyl]-5-dibenzofuran-4-ylphenyl]-6-(3-isocyanophenyl)-2-phenylpyrimidine |
| SMILES | [C-]#[N+]c1cccc(-c2cc(-c3cc(-c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)cc(-c4cccc5c4oc4ccccc45)c3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C51H39N3O/c1-52-42-12-7-11-37(27-42)46-28-47(54-50(53-46)36-9-3-2-4-10-36)40-25-38(24-39(26-40)43-14-8-15-45-44-13-5-6-16-48(44)55-49(43)45)35-17-19-41(20-18-35)51-29-32-21-33(30-51)23-34(22-32)31-51/h2-20,24-28,32-34H,21-23,29-31H2 |
| InChIKey | TWGMNNNXPIWZNT-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 43.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.89 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|