C55H41N3O2 — CID 169054827
2-[3-[4-(1-adamantyl)phenyl]-5-(4-deuteriophenyl)phenyl]-4,6-di(dibenzofuran-4-yl)-1,3,5-triazine (PubChem CID 169054827) has the molecular formula C55H41N3O2 and a molecular weight of 776.96 g/mol. Its IUPAC name is 2-[3-[4-(1-adamantyl)phenyl]-5-(4-deuteriophenyl)phenyl]-4,6-di(dibenzofuran-4-yl)-1,3,5-triazine.
| Compound Name | 2-[3-[4-(1-adamantyl)phenyl]-5-(4-deuteriophenyl)phenyl]-4,6-di(dibenzofuran-4-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 169054827 |
| Molecular Formula | C55H41N3O2 |
| Molecular Weight | 776.96 g/mol |
| Exact Mass | 776.33 |
| IUPAC Name | 2-[3-[4-(1-adamantyl)phenyl]-5-(4-deuteriophenyl)phenyl]-4,6-di(dibenzofuran-4-yl)-1,3,5-triazine |
| SMILES | [2H]c1ccc(-c2cc(-c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)cc(-c3nc(-c4cccc5c4oc4ccccc45)nc(-c4cccc5c4oc4ccccc45)n3)c2)cc1 |
| InChI | InChI=1S/C55H41N3O2/c1-2-10-36(11-3-1)38-27-39(37-20-22-41(23-21-37)55-30-33-24-34(31-55)26-35(25-33)32-55)29-40(28-38)52-56-53(46-16-8-14-44-42-12-4-6-18-48(42)59-50(44)46)58-54(57-52)47-17-9-15-45-43-13-5-7-19-49(43)60-51(45)47/h1-23,27-29,33-35H,24-26,30-32H2/i1D |
| InChIKey | YPBGBDNOLODXJN-MICDWDOJSA-N |
| XLogP | 14.47 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.96 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |