C55H40N4O2 — CID 169054812
2-(1-adamantyl)-7-[4-(8-deuteriodibenzofuran-4-yl)-6-dibenzofuran-4-yl-1,3,5-triazin-2-yl]-9-phenylcarbazole (PubChem CID 169054812) has the molecular formula C55H40N4O2 and a molecular weight of 789.96 g/mol. Its IUPAC name is 2-(1-adamantyl)-7-[4-(8-deuteriodibenzofuran-4-yl)-6-dibenzofuran-4-yl-1,3,5-triazin-2-yl]-9-phenylcarbazole.
| Compound Name | 2-(1-adamantyl)-7-[4-(8-deuteriodibenzofuran-4-yl)-6-dibenzofuran-4-yl-1,3,5-triazin-2-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 169054812 |
| Molecular Formula | C55H40N4O2 |
| Molecular Weight | 789.96 g/mol |
| Exact Mass | 789.32 |
| IUPAC Name | 2-(1-adamantyl)-7-[4-(8-deuteriodibenzofuran-4-yl)-6-dibenzofuran-4-yl-1,3,5-triazin-2-yl]-9-phenylcarbazole |
| SMILES | [2H]c1ccc2oc3c(-c4nc(-c5ccc6c7ccc(C89CC%10CC(CC(C%10)C8)C9)cc7n(-c7ccccc7)c6c5)nc(-c5cccc6c5oc5ccccc56)n4)cccc3c2c1 |
| InChI | InChI=1S/C55H40N4O2/c1-2-10-37(11-3-1)59-46-27-35(20-22-38(46)39-23-21-36(28-47(39)59)55-29-32-24-33(30-55)26-34(25-32)31-55)52-56-53(44-16-8-14-42-40-12-4-6-18-48(40)60-50(42)44)58-54(57-52)45-17-9-15-43-41-13-5-7-19-49(41)61-51(43)45/h1-23,27-28,32-34H,24-26,29-31H2/i4D |
| InChIKey | JUQQNIVQFXQXFC-QYKNYGDISA-N |
| XLogP | 14.24 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.96 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |