C54H48N4O — CID 168808020
8-[4-[4,6-bis[4-(1-adamantyl)phenyl]-1,3,5-triazin-2-yl]phenyl]dibenzofuran-4-carbonitrile (PubChem CID 168808020) has the molecular formula C54H48N4O and a molecular weight of 769.01 g/mol. Its IUPAC name is 8-[4-[4,6-bis[4-(1-adamantyl)phenyl]-1,3,5-triazin-2-yl]phenyl]dibenzofuran-4-carbonitrile.
| Compound Name | 8-[4-[4,6-bis[4-(1-adamantyl)phenyl]-1,3,5-triazin-2-yl]phenyl]dibenzofuran-4-carbonitrile |
|---|---|
| PubChem CID | 168808020 |
| Molecular Formula | C54H48N4O |
| Molecular Weight | 769.01 g/mol |
| Exact Mass | 768.38 |
| IUPAC Name | 8-[4-[4,6-bis[4-(1-adamantyl)phenyl]-1,3,5-triazin-2-yl]phenyl]dibenzofuran-4-carbonitrile |
| SMILES | N#Cc1cccc2c1oc1ccc(-c3ccc(-c4nc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)nc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)n4)cc3)cc12 |
| InChI | InChI=1S/C54H48N4O/c55-31-43-2-1-3-46-47-24-42(12-17-48(47)59-49(43)46)38-4-6-39(7-5-38)50-56-51(40-8-13-44(14-9-40)53-25-32-18-33(26-53)20-34(19-32)27-53)58-52(57-50)41-10-15-45(16-11-41)54-28-35-21-36(29-54)23-37(22-35)30-54/h1-17,24,32-37H,18-23,25-30H2 |
| InChIKey | VEXHUDTYSCYVMM-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 75.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.01 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |