C40H34N2O — CID 176871975
7-[4-[2-[4-(1-adamantyl)phenyl]-6-phenyl-4-pyridinyl]phenyl]-1,3-benzoxazole (PubChem CID 176871975) has the molecular formula C40H34N2O and a molecular weight of 558.73 g/mol. Its IUPAC name is 7-[4-[2-[4-(1-adamantyl)phenyl]-6-phenyl-4-pyridinyl]phenyl]-1,3-benzoxazole.
| Compound Name | 7-[4-[2-[4-(1-adamantyl)phenyl]-6-phenyl-4-pyridinyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 176871975 |
| Molecular Formula | C40H34N2O |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | 7-[4-[2-[4-(1-adamantyl)phenyl]-6-phenyl-4-pyridinyl]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4cccc5ncoc45)cc3)cc(-c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)n2)cc1 |
| InChI | InChI=1S/C40H34N2O/c1-2-5-31(6-3-1)37-20-33(29-9-11-30(12-10-29)35-7-4-8-36-39(35)43-25-41-36)21-38(42-37)32-13-15-34(16-14-32)40-22-26-17-27(23-40)19-28(18-26)24-40/h1-16,20-21,25-28H,17-19,22-24H2 |
| InChIKey | VAPHXTFOYBGAEU-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |