C45H38BrN — CID 164818783
4-[3-[4-[3-(4-bromophenyl)-1-adamantyl]phenyl]phenyl]-2,6-diphenylpyridine (PubChem CID 164818783) has the molecular formula C45H38BrN and a molecular weight of 672.71 g/mol. Its IUPAC name is 4-[3-[4-[3-(4-bromophenyl)-1-adamantyl]phenyl]phenyl]-2,6-diphenylpyridine.
| Compound Name | 4-[3-[4-[3-(4-bromophenyl)-1-adamantyl]phenyl]phenyl]-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 164818783 |
| Molecular Formula | C45H38BrN |
| Molecular Weight | 672.71 g/mol |
| Exact Mass | 671.22 |
| IUPAC Name | 4-[3-[4-[3-(4-bromophenyl)-1-adamantyl]phenyl]phenyl]-2,6-diphenylpyridine |
| SMILES | Brc1ccc(C23CC4CC(C2)CC(c2ccc(-c5cccc(-c6cc(-c7ccccc7)nc(-c7ccccc7)c6)c5)cc2)(C4)C3)cc1 |
| InChI | InChI=1S/C45H38BrN/c46-41-20-18-40(19-21-41)45-28-31-22-32(29-45)27-44(26-31,30-45)39-16-14-33(15-17-39)36-12-7-13-37(23-36)38-24-42(34-8-3-1-4-9-34)47-43(25-38)35-10-5-2-6-11-35/h1-21,23-25,31-32H,22,26-30H2 |
| InChIKey | HILWDTMWVKTHAU-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.71 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |