C56H44N4 — CID 164818569
3-[4-[3-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-1-adamantyl]phenyl]benzonitrile (PubChem CID 164818569) has the molecular formula C56H44N4 and a molecular weight of 773.00 g/mol. Its IUPAC name is 3-[4-[3-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-1-adamantyl]phenyl]benzonitrile.
| Compound Name | 3-[4-[3-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-1-adamantyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 164818569 |
| Molecular Formula | C56H44N4 |
| Molecular Weight | 773.00 g/mol |
| Exact Mass | 772.36 |
| IUPAC Name | 3-[4-[3-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-1-adamantyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(C34CC5CC(CC(c6ccc(-c7ccc(-c8ccc(-c9nc(-c%10ccccc%10)nc(-c%10ccccc%10)n9)cc8)cc7)cc6)(C5)C3)C4)cc2)c1 |
| InChI | InChI=1S/C56H44N4/c57-36-38-8-7-13-49(31-38)45-24-28-51(29-25-45)56-34-39-30-40(35-56)33-55(32-39,37-56)50-26-22-44(23-27-50)42-16-14-41(15-17-42)43-18-20-48(21-19-43)54-59-52(46-9-3-1-4-10-46)58-53(60-54)47-11-5-2-6-12-47/h1-29,31,39-40H,30,32-35,37H2 |
| InChIKey | YMBIIBBKTZXNKY-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.00 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |