C56H52N2O — CID 176871966
4-[3-[4-[2,6-bis[4-(1-adamantyl)phenyl]-4-pyridinyl]phenyl]phenyl]-1,3-benzoxazole (PubChem CID 176871966) has the molecular formula C56H52N2O and a molecular weight of 769.05 g/mol. Its IUPAC name is 4-[3-[4-[2,6-bis[4-(1-adamantyl)phenyl]-4-pyridinyl]phenyl]phenyl]-1,3-benzoxazole.
| Compound Name | 4-[3-[4-[2,6-bis[4-(1-adamantyl)phenyl]-4-pyridinyl]phenyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 176871966 |
| Molecular Formula | C56H52N2O |
| Molecular Weight | 769.05 g/mol |
| Exact Mass | 768.41 |
| IUPAC Name | 4-[3-[4-[2,6-bis[4-(1-adamantyl)phenyl]-4-pyridinyl]phenyl]phenyl]-1,3-benzoxazole |
| SMILES | c1cc(-c2ccc(-c3cc(-c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)nc(-c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)c3)cc2)cc(-c2cccc3ocnc23)c1 |
| InChI | InChI=1S/C56H52N2O/c1-3-45(25-46(4-1)50-5-2-6-53-54(50)57-34-59-53)41-7-9-42(10-8-41)47-26-51(43-11-15-48(16-12-43)55-28-35-19-36(29-55)21-37(20-35)30-55)58-52(27-47)44-13-17-49(18-14-44)56-31-38-22-39(32-56)24-40(23-38)33-56/h1-18,25-27,34-40H,19-24,28-33H2 |
| InChIKey | FDJGIWQPFGUKHZ-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.05 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |