C42H34N4 — CID 168808393
2-[4-[4-(1-adamantyl)naphthalen-1-yl]-2-isocyanophenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 168808393) has the molecular formula C42H34N4 and a molecular weight of 594.76 g/mol. Its IUPAC name is 2-[4-[4-(1-adamantyl)naphthalen-1-yl]-2-isocyanophenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[4-(1-adamantyl)naphthalen-1-yl]-2-isocyanophenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168808393 |
| Molecular Formula | C42H34N4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 2-[4-[4-(1-adamantyl)naphthalen-1-yl]-2-isocyanophenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1cc(-c2ccc(C34CC5CC(CC(C5)C3)C4)c3ccccc23)ccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C42H34N4/c1-43-38-23-32(16-17-36(38)41-45-39(30-10-4-2-5-11-30)44-40(46-41)31-12-6-3-7-13-31)33-18-19-37(35-15-9-8-14-34(33)35)42-24-27-20-28(25-42)22-29(21-27)26-42/h2-19,23,27-29H,20-22,24-26H2 |
| InChIKey | PIGCBBADZBZABX-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|