C42H28N4O — CID 176872024
4-(3-cuban-1-ylphenyl)-7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-benzoxazole (PubChem CID 176872024) has the molecular formula C42H28N4O and a molecular weight of 604.71 g/mol. Its IUPAC name is 4-(3-cuban-1-ylphenyl)-7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-benzoxazole.
| Compound Name | 4-(3-cuban-1-ylphenyl)-7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 176872024 |
| Molecular Formula | C42H28N4O |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | 4-(3-cuban-1-ylphenyl)-7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc(-c5cccc(C67C8C9C%10C8C6C%10C97)c5)c5ncoc45)c3)n2)cc1 |
| InChI | InChI=1S/C42H28N4O/c1-3-9-22(10-4-1)39-44-40(23-11-5-2-6-12-23)46-41(45-39)26-15-7-13-24(19-26)29-18-17-28(37-38(29)47-21-43-37)25-14-8-16-27(20-25)42-34-31-30-32(34)36(42)33(30)35(31)42/h1-21,30-36H |
| InChIKey | AIANQZWWYLSQDT-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |