C55H41N5 — CID 164818583
3-[4-[2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-2-adamantyl]naphthalen-1-yl]-5-isocyanobenzonitrile (PubChem CID 164818583) has the molecular formula C55H41N5 and a molecular weight of 771.97 g/mol. Its IUPAC name is 3-[4-[2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-2-adamantyl]naphthalen-1-yl]-5-isocyanobenzonitrile.
| Compound Name | 3-[4-[2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-2-adamantyl]naphthalen-1-yl]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 164818583 |
| Molecular Formula | C55H41N5 |
| Molecular Weight | 771.97 g/mol |
| Exact Mass | 771.34 |
| IUPAC Name | 3-[4-[2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-2-adamantyl]naphthalen-1-yl]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2ccc(C3(c4ccc(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)cc4)C4CC5CC(C4)CC3C5)c3ccccc23)c1 |
| InChI | InChI=1S/C55H41N5/c1-57-47-32-37(34-56)27-43(33-47)48-24-25-51(50-15-9-8-14-49(48)50)55(45-28-35-26-36(30-45)31-46(55)29-35)44-22-20-39(21-23-44)38-16-18-42(19-17-38)54-59-52(40-10-4-2-5-11-40)58-53(60-54)41-12-6-3-7-13-41/h2-25,27,32-33,35-36,45-46H,26,28-31H2 |
| InChIKey | MTHPPCZTSCAPAB-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 66.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.97 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|