C46H40N4Si — CID 164818654
4-[2-[4-[4-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-2-adamantyl]benzonitrile (PubChem CID 164818654) has the molecular formula C46H40N4Si and a molecular weight of 676.94 g/mol. Its IUPAC name is 4-[2-[4-[4-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-2-adamantyl]benzonitrile.
| Compound Name | 4-[2-[4-[4-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-2-adamantyl]benzonitrile |
|---|---|
| PubChem CID | 164818654 |
| Molecular Formula | C46H40N4Si |
| Molecular Weight | 676.94 g/mol |
| Exact Mass | 676.30 |
| IUPAC Name | 4-[2-[4-[4-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-2-adamantyl]benzonitrile |
| SMILES | C[Si]1(C)c2ccccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(C5(c6ccc(C#N)cc6)C6CC7CC(C6)CC5C7)cc4)n3)cc21 |
| InChI | InChI=1S/C46H40N4Si/c1-51(2)41-11-7-6-10-39(41)40-21-16-34(27-42(40)51)45-49-43(32-8-4-3-5-9-32)48-44(50-45)33-14-19-36(20-15-33)46(35-17-12-29(28-47)13-18-35)37-23-30-22-31(25-37)26-38(46)24-30/h3-21,27,30-31,37-38H,22-26H2,1-2H3 |
| InChIKey | LFHAAVMWGRFPIL-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.94 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|