C44H34N4 — CID 168798709
2-[5'-(4-isocyanophenyl)spiro[adamantane-2,9'-fluorene]-2'-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 168798709) has the molecular formula C44H34N4 and a molecular weight of 618.78 g/mol. Its IUPAC name is 2-[5'-(4-isocyanophenyl)spiro[adamantane-2,9'-fluorene]-2'-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[5'-(4-isocyanophenyl)spiro[adamantane-2,9'-fluorene]-2'-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168798709 |
| Molecular Formula | C44H34N4 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 2-[5'-(4-isocyanophenyl)spiro[adamantane-2,9'-fluorene]-2'-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c2-c2ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc2C32C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C44H34N4/c1-45-35-18-15-29(16-19-35)36-13-8-14-38-40(36)37-20-17-32(26-39(37)44(38)33-22-27-21-28(24-33)25-34(44)23-27)43-47-41(30-9-4-2-5-10-30)46-42(48-43)31-11-6-3-7-12-31/h2-20,26-28,33-34H,21-25H2 |
| InChIKey | OBXWFJIFVCGUTB-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|