C54H40N4 — CID 168798741
2-[4-[5'-(4-isocyanonaphthalen-1-yl)spiro[adamantane-2,9'-fluorene]-1'-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 168798741) has the molecular formula C54H40N4 and a molecular weight of 744.94 g/mol. Its IUPAC name is 2-[4-[5'-(4-isocyanonaphthalen-1-yl)spiro[adamantane-2,9'-fluorene]-1'-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[5'-(4-isocyanonaphthalen-1-yl)spiro[adamantane-2,9'-fluorene]-1'-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168798741 |
| Molecular Formula | C54H40N4 |
| Molecular Weight | 744.94 g/mol |
| Exact Mass | 744.33 |
| IUPAC Name | 2-[4-[5'-(4-isocyanonaphthalen-1-yl)spiro[adamantane-2,9'-fluorene]-1'-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c2-c2cccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c2C32C3CC4CC(C3)CC2C4)c2ccccc12 |
| InChI | InChI=1S/C54H40N4/c1-55-48-27-26-43(42-16-8-9-17-44(42)48)45-19-11-21-47-49(45)46-20-10-18-41(50(46)54(47)39-29-33-28-34(31-39)32-40(54)30-33)35-22-24-38(25-23-35)53-57-51(36-12-4-2-5-13-36)56-52(58-53)37-14-6-3-7-15-37/h2-27,33-34,39-40H,28-32H2 |
| InChIKey | XYRMNIMNERAYPY-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.94 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|