C34H21N5 — CID 123235900
3-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-isocyano-9-phenylcarbazole (PubChem CID 123235900) has the molecular formula C34H21N5 and a molecular weight of 499.58 g/mol. Its IUPAC name is 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-isocyano-9-phenylcarbazole.
| Compound Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-isocyano-9-phenylcarbazole |
|---|---|
| PubChem CID | 123235900 |
| Molecular Formula | C34H21N5 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-isocyano-9-phenylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C34H21N5/c1-35-26-18-20-31-29(22-26)28-21-25(17-19-30(28)39(31)27-15-9-4-10-16-27)34-37-32(23-11-5-2-6-12-23)36-33(38-34)24-13-7-3-8-14-24/h2-22H |
| InChIKey | NZPVSNPYTWMTCK-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|