C56H33N5 — CID 123508714
3-(10-anthracen-9-ylanthracen-9-yl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-isocyanocarbazole (PubChem CID 123508714) has the molecular formula C56H33N5 and a molecular weight of 775.92 g/mol. Its IUPAC name is 3-(10-anthracen-9-ylanthracen-9-yl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-isocyanocarbazole.
| Compound Name | 3-(10-anthracen-9-ylanthracen-9-yl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-isocyanocarbazole |
|---|---|
| PubChem CID | 123508714 |
| Molecular Formula | C56H33N5 |
| Molecular Weight | 775.92 g/mol |
| Exact Mass | 775.27 |
| IUPAC Name | 3-(10-anthracen-9-ylanthracen-9-yl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-isocyanocarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3c4ccccc4c(-c4c5ccccc5cc5ccccc45)c4ccccc34)ccc1n2-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C56H33N5/c1-57-40-29-31-50-48(34-40)47-33-39(28-30-49(47)61(50)56-59-54(35-16-4-2-5-17-35)58-55(60-56)36-18-6-3-7-19-36)51-43-24-12-14-26-45(43)53(46-27-15-13-25-44(46)51)52-41-22-10-8-20-37(41)32-38-21-9-11-23-42(38)52/h2-34H |
| InChIKey | GUZWBDKBXUBBEF-UHFFFAOYSA-N |
| XLogP | 14.80 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.92 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|